676596-64-8 Usage
Description
7,8-Dihydro-9-[2-(4-bromophenyl)hydrazone]-5H-pyrido[3,2-b]azepine-6,9-dione is a chemical compound that functions as a GSK-3 inhibitor. It is characterized by its unique molecular structure, which includes a pyridoazepine core and a bromophenylhydrazone moiety. 7,8-Dihydro-9-[2-(4-bromophenyl)hydrazone]-5H-pyrido[3,2-b]azepine-6,9-dione has potential applications in various fields due to its inhibitory properties.
Uses
Used in Pharmaceutical Industry:
7,8-Dihydro-9-[2-(4-bromophenyl)hydrazone]-5H-pyrido[3,2-b]azepine-6,9-dione is used as a GSK-3 inhibitor for its potential role in the development of therapeutic agents targeting glycogen synthase kinase-3 (GSK-3). GSK-3 is a serine/threonine kinase involved in various cellular processes, and its inhibition has been linked to the treatment of several diseases, including neurodegenerative disorders and cancer.
Used in Cell Culture Applications:
7,8-Dihydro-9-[2-(4-bromophenyl)hydrazone]-5H-pyrido[3,2-b]azepine-6,9-dione is used as a reagent to maintain the potency of cultured multipotent non-embryonic progenitor cells. Its GSK-3 inhibitory activity may contribute to the preservation of the cells' stemness and self-renewal capabilities, which is crucial for various regenerative medicine and tissue engineering applications.
Used in Chemical Synthesis:
7,8-Dihydro-9-[2-(4-bromophenyl)hydrazone]-5H-pyrido[3,2-b]azepine-6,9-dione serves as an intermediate in the synthesis of 1-Azakenpaullone and other Kenpaullone derivatives. These compounds have potential applications in various fields, including pharmaceuticals and materials science, due to their unique chemical properties and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 676596-64-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,6,5,9 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 676596-64:
(8*6)+(7*7)+(6*6)+(5*5)+(4*9)+(3*6)+(2*6)+(1*4)=228
228 % 10 = 8
So 676596-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H13BrN4O/c16-10-3-5-11(6-4-10)19-20-13-7-8-14(21)18-12-2-1-9-17-15(12)13/h1-6,9,19H,7-8H2,(H,18,21)/b20-13+
676596-64-8Relevant articles and documents
9-Cyano-1-azapaullone (Cazpaullone), a Glycogen Synthase Kinase-3 (GSK-3) inhibitor activating pancreatic β cell protection and replication
Stukenbrock, Hendrik,Mussmann, Rainer,Geese, Marcus,Ferandin, Yoan,Lozach, Olivier,Lemcke, Thomas,Kegel, Simone,Lomow, Alexander,Burk, Ulrike,Dohrmann, Cord,Meijer, Laurent,Austen, Matthias,Kunick, Conrad
, p. 2196 - 2207 (2008/12/22)
Recently, the serine/threonine kinase glycogen synthase kinase-3 (GSK-3) emerged as a regulator of pancreatic β cell growth and survival. On the basis of the previous observation that GSK-3 inhibitors like 1-azakenpaullone promote β cell protection and re
