67679-63-4 Usage
General Description
4-Ethoxyphenyl 4-pentylcyclohexanecarboxylate is a chemical compound with the molecular formula C21H30O3. It is an ester, meaning it is formed from the reaction of an alcohol and a carboxylic acid. 4-ETHOXYPHENYL 4-PENTYLCYCLOHEXANECARBOXYLATE is commonly used in the fragrance and flavor industries due to its aromatic properties. It has a sweet and floral odor, making it a popular ingredient in perfumes, colognes, and other scented products. Additionally, it is also used in the production of cosmetics and personal care products. Its ability to provide a long-lasting and pleasant scent makes it a valuable component in various consumer goods.
Check Digit Verification of cas no
The CAS Registry Mumber 67679-63-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,6,7 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 67679-63:
(7*6)+(6*7)+(5*6)+(4*7)+(3*9)+(2*6)+(1*3)=184
184 % 10 = 4
So 67679-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H30O3/c1-3-5-6-7-16-8-10-17(11-9-16)20(21)23-19-14-12-18(13-15-19)22-4-2/h12-17H,3-11H2,1-2H3