67786-53-2 Usage
Description
6,9-DIOXO-11ALPHA,15S-DIHYDROXY-PROST-13E-EN-1-OIC ACID, also known as 6-Keto-PGE1, is a metabolite of prostacyclin, an eicosanoid that plays a crucial role in the regulation of blood flow and platelet aggregation. It is characterized by its unique chemical structure, featuring a 13E-en-1-oic acid moiety, 6,9-dioxo groups, and 11alpha,15S-dihydroxy functionalities.
Uses
Used in Pharmaceutical Industry:
6,9-DIOXO-11ALPHA,15S-DIHYDROXY-PROST-13E-EN-1-OIC ACID is used as a therapeutic agent for its vasodilatory properties. It helps in preventing the formation of platelet plugs, which can lead to blood clots and other cardiovascular issues. Its ability to dilate blood vessels makes it a valuable compound in the treatment of various cardiovascular diseases.
Used in Research Applications:
6-Keto-PGE1 is also used as a research tool to study the mechanisms of prostacyclin and its role in physiological processes. It aids scientists in understanding the complex interactions between eicosanoids and their receptors, which can contribute to the development of new drugs and therapies for various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 67786-53-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,7,8 and 6 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 67786-53:
(7*6)+(6*7)+(5*7)+(4*8)+(3*6)+(2*5)+(1*3)=182
182 % 10 = 2
So 67786-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H32O6/c1-2-3-4-7-14(21)10-11-16-17(19(24)13-18(16)23)12-15(22)8-5-6-9-20(25)26/h10-11,14,16-18,21,23H,2-9,12-13H2,1H3,(H,25,26)/b11-10+/t14-,16+,17+,18+/m0/s1