67823-66-9 Usage
Description
2-(2-FURYLMETHYL)CYCLOHEXANAMINE is an organic compound that features a cyclohexanamine core with a furylmethyl group attached to the 2nd carbon. This structure endows it with unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-(2-FURYLMETHYL)CYCLOHEXANAMINE is used as an intermediate in the synthesis of various biologically active compounds for the pharmaceutical industry. Its unique structure allows it to be a key component in the creation of new drugs with potential therapeutic benefits.
Used in Chemical Synthesis:
2-(2-FURYLMETHYL)CYCLOHEXANAMINE is used as a reagent in the oxidative coupling of 3,4,4a,5-tetrahydropyrido[1,2-a]benzimidazoles with some biologically active amines. This application is significant for the development of novel chemical entities with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 67823-66-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,8,2 and 3 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 67823-66:
(7*6)+(6*7)+(5*8)+(4*2)+(3*3)+(2*6)+(1*6)=159
159 % 10 = 9
So 67823-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO/c12-11-6-2-1-4-9(11)8-10-5-3-7-13-10/h3,5,7,9,11H,1-2,4,6,8,12H2/p+1/t9-,11-/m1/s1