67952-59-4 Usage
General Description
2-Methylthio-3-isopropylpyrazine is a chemical compound that is commonly found in nature and is known for its strong, earthy odor. It is often used as a flavoring and fragrance ingredient in the food and beverage industry, adding a distinct roasted, nutty, and coffee-like aroma to products. 2-METHYLTHIO-3-ISOPROPYLPYRAZINE is also found in various plants, such as certain vegetables and herbs. In addition to its use in the food and beverage industry, 2-methylthio-3-isopropylpyrazine has also been studied for its potential insect-repellent properties due to its natural presence in certain plants. Overall, this chemical compound is valued for its aromatic properties and potential functional uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 67952-59-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,9,5 and 2 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 67952-59:
(7*6)+(6*7)+(5*9)+(4*5)+(3*2)+(2*5)+(1*9)=174
174 % 10 = 4
So 67952-59-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2S/c1-6(2)7-8(11-3)10-5-4-9-7/h4-6H,1-3H3