67992-58-9 Usage
Description
Sodium 3-[[[[3-(acetylmethylamino)-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoyl]amino]acetyl]amino]-5-[[(2-hydroxyethyl)amino]carbonyl]-2,4,6-triiodobenzoate is a complex organic compound with a unique molecular structure. It is characterized by its multiple iodo and amino groups, which may contribute to its potential applications in various fields.
Uses
Used in Medical Imaging:
Sodium 3-[[[[3-(acetylmethylamino)-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoyl]amino]acetyl]amino]-5-[[(2-hydroxyethyl)amino]carbonyl]-2,4,6-triiodobenzoate is used as a contrast agent for X-Ray imaging. Its high iodine content and unique molecular structure allow for enhanced visualization of internal body structures during diagnostic procedures.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, sodium 3-[[[[3-(acetylmethylamino)-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoyl]amino]acetyl]amino]-5-[[(2-hydroxyethyl)amino]carbonyl]-2,4,6-triiodobenzoate may be utilized as an active pharmaceutical ingredient or as a component in the development of new drugs. Its specific properties, such as its multiple iodo and amino groups, could potentially be exploited for targeted drug delivery or as a building block in the synthesis of novel therapeutic agents.
Used in Research and Development:
Due to its complex structure and unique properties, sodium 3-[[[[3-(acetylmethylamino)-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoyl]amino]acetyl]amino]-5-[[(2-hydroxyethyl)amino]carbonyl]-2,4,6-triiodobenzoate may also be valuable in research and development settings. It could be used as a starting material or a model compound for studying various chemical reactions, understanding the properties of similar compounds, or developing new methodologies in organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 67992-58-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,9,9 and 2 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 67992-58:
(7*6)+(6*7)+(5*9)+(4*9)+(3*2)+(2*5)+(1*8)=189
189 % 10 = 9
So 67992-58-9 is a valid CAS Registry Number.
InChI:InChI=1/C24H21I6N5O8.Na/c1-7(37)35(3)20-17(29)10(21(39)31-2)13(25)11(18(20)30)23(41)33-6-8(38)34-19-15(27)9(22(40)32-4-5-36)14(26)12(16(19)28)24(42)43;/h36H,4-6H2,1-3H3,(H,31,39)(H,32,40)(H,33,41)(H,34,38)(H,42,43);/q;+1/p-1