6807-96-1 Usage
Description
Versicolorin A is an organic heteropentacyclic compound, specifically a 3a,12a-dihydroanthra[2,3-b]furo[3,2-d]furan-5,10-dione, which features three hydroxy substituents at positions 4, 6, and 8.
Uses
1. Used in Pharmaceutical Industry:
Versicolorin A is used as a pharmaceutical compound for its potential therapeutic properties. versicolorin A's unique structure and functional groups may allow it to interact with various biological targets, making it a candidate for the development of new drugs.
2. Used in Chemical Research:
Versicolorin A can be utilized as a research tool in the field of organic chemistry, particularly in studying the properties and reactions of heteropentacyclic compounds. Its structure may provide insights into the synthesis and modification of similar compounds for various applications.
3. Used in Material Science:
Due to its unique chemical structure, versicolorin A may have potential applications in material science, possibly as a component in the development of new materials with specific properties, such as improved stability or reactivity.
4. Used in Environmental Applications:
Versicolorin A's chemical properties may also make it suitable for environmental applications, such as in the remediation of contaminated sites or the development of eco-friendly materials.
Check Digit Verification of cas no
The CAS Registry Mumber 6807-96-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,8,0 and 7 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6807-96:
(6*6)+(5*8)+(4*0)+(3*7)+(2*9)+(1*6)=121
121 % 10 = 1
So 6807-96-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H10O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h1-5,7,18-20,23H/t7-,18+/m0/s1