68074-63-5 Usage
General Description
1H-IMIDAZO[4,5-C]PYRIDIN-2-AMINE is a chemical compound with the molecular formula C8H7N3. It is a heterocyclic compound containing both imidazole and pyridine rings. 1H-IMIDAZO[4,5-C]PYRIDIN-2-AMINE has potential applications in the pharmaceutical industry, as it can be used as a building block for the synthesis of various biologically active molecules. Additionally, some derivatives of 1H-IMIDAZO[4,5-C]PYRIDIN-2-AMINE have been studied for their potential antitumor and antimicrobial properties. Overall, 1H-IMIDAZO[4,5-C]PYRIDIN-2-AMINE is an important chemical compound with potential pharmacological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 68074-63-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,0,7 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 68074-63:
(7*6)+(6*8)+(5*0)+(4*7)+(3*4)+(2*6)+(1*3)=145
145 % 10 = 5
So 68074-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-6-9-4-1-2-8-3-5(4)10-6/h1-3H,(H3,7,9,10)