68112-21-0 Usage
Description
2H-Pyran-2-one, 3,5-dibutyl-6-(1-butyl-2-oxoheptyl)-4-hydroxyis a complex organic compound characterized by its unique molecular structure. It is derived from the pyranone family, which is known for its diverse range of biological activities and potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
2H-Pyran-2-one, 3,5-dibutyl-6-(1-butyl-2-oxoheptyl)-4-hydroxyis used as a pharmaceutical compound for its potential therapeutic properties. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Cosmetic Industry:
In the cosmetic industry, 2H-Pyran-2-one, 3,5-dibutyl-6-(1-butyl-2-oxoheptyl)-4-hydroxyis used as an active ingredient for its potential skin benefits. Its ability to modulate certain biological pathways may contribute to improved skin health and appearance.
Used in Chemical Research:
2H-Pyran-2-one, 3,5-dibutyl-6-(1-butyl-2-oxoheptyl)-4-hydroxyis also used in chemical research as a starting material or intermediate for the synthesis of more complex molecules. Its unique properties make it a valuable tool for exploring new chemical reactions and developing novel compounds.
Used in Elastase Inhibition:
2H-Pyran-2-one, 3,5-dibutyl-6-(1-butyl-2-oxoheptyl)-4-hydroxyis used as a reversible inhibitor of human granulocyte elastase, similar to Elasnin. This application is particularly relevant in the development of treatments for conditions associated with elastase overactivity, such as certain inflammatory diseases and tissue degradation disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 68112-21-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,1 and 2 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 68112-21:
(7*6)+(6*8)+(5*1)+(4*1)+(3*2)+(2*2)+(1*1)=110
110 % 10 = 0
So 68112-21-0 is a valid CAS Registry Number.
InChI:InChI=1/C24H40O4/c1-5-9-13-17-21(25)18(14-10-6-2)23-19(15-11-7-3)22(26)20(16-12-8-4)24(27)28-23/h18,27H,5-17H2,1-4H3