68161-57-9 Usage
Description
[5-(CYCLOHEXYLAMINO)-1,3,4-THIADIAZOL-2-YL]THIOACETIC ACID is a chemical compound characterized by its complex structure, belonging to the class of thiadiazole derivatives. It features a thiol group and an amino group, with the presence of a thiadiazole ring that may contribute to its potential biological and pharmacological activities. This unique structure allows it to interact with various biological targets, making it a promising candidate for applications in medicinal chemistry, drug development, and chemical research.
Uses
Used in Medicinal Chemistry:
[5-(CYCLOHEXYLAMINO)-1,3,4-THIADIAZOL-2-YL]THIOACETIC ACID is used as a compound in medicinal chemistry for its potential to exhibit biological and pharmacological activities due to its thiadiazole ring and functional groups.
Used in Drug Development:
In the field of drug development, [5-(CYCLOHEXYLAMINO)-1,3,4-THIADIAZOL-2-YL]THIOACETIC ACID is used as a starting material or a structural component for designing new drugs, leveraging its unique properties and interactions with biological targets.
Used in Chemical Research and Synthesis:
[5-(CYCLOHEXYLAMINO)-1,3,4-THIADIAZOL-2-YL]THIOACETIC ACID is utilized as a compound in chemical research and synthesis, taking advantage of its interesting structural features for the development of novel chemical entities and potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 68161-57-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,6 and 1 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68161-57:
(7*6)+(6*8)+(5*1)+(4*6)+(3*1)+(2*5)+(1*7)=139
139 % 10 = 9
So 68161-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N3O2S2/c14-8(15)6-16-10-13-12-9(17-10)11-7-4-2-1-3-5-7/h7H,1-6H2,(H,11,12)(H,14,15)
