68214-68-6 Usage
Properties
1. Chemical Nature: Organic compound
2. IUPAC Name: 29-(2,4-dipentylphenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol
3. Molecular Formula: C40H82O10
4. Functional Groups: Phenoxy group (-O-Ph), long nonaoxanonacosanol chain
5. Derived From: Plants
6. Carbon Chain Length: Long carbon chain (29 carbons in the nonaoxanonacosanol chain)
7. Biological Activities: Potential anti-inflammatory and anti-cancer properties
8. Uses: Production of surfactants and cosmetics
Specific Content
1. Phenoxy Group: Attached to the nonaoxanonacosanol chain
2. Nonaoxanonacosanol Chain: Consists of 29 carbon atoms with 10 oxygen atoms interspersed
3. Alcohol Functionality: Presence of hydroxyl (-OH) groups due to being an alcohol
4. Hydrocarbon Chain: Pentyl groups attached to the phenoxy group, contributing to the overall structure and properties
5. Potential Biological Activities: Anti-inflammatory and anti-cancer properties associated with nonacosanols
6. Industrial Applications: Used in the production of surfactants and cosmetics due to its surfactant properties and emollient effects
7. Research Requirement: Further studies needed to elucidate specific biological activities and potential applications of this compound
These properties and content highlights the complex nature and potential applications of 29-(2,4-dipentylphenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol, showcasing its significance in both biological and industrial contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 68214-68-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,2,1 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 68214-68:
(7*6)+(6*8)+(5*2)+(4*1)+(3*4)+(2*6)+(1*8)=136
136 % 10 = 6
So 68214-68-6 is a valid CAS Registry Number.
InChI:InChI=1/C36H66O11/c1-3-5-7-9-34-11-12-36(35(33-34)10-8-6-4-2)47-32-31-46-30-29-45-28-27-44-26-25-43-24-23-42-22-21-41-20-19-40-18-17-39-16-15-38-14-13-37/h11-12,33,37H,3-10,13-32H2,1-2H3