68385-79-5 Usage
General Description
"N-[3-amino-4-(2-methoxyethoxy)phenyl]acetamide" is a chemical compound with the molecular formula C11H16N2O3. It is an amide derivative of acetamide and contains an amino group, a phenyl group, and an ethoxy group. N-[3-amino-4-(2-methoxyethoxy)phenyl]acetamide has potential pharmaceutical applications due to its ability to modulate biological pathways and interact with specific protein targets. It may be used in the development of new drugs for conditions such as inflammation, pain, and neurological disorders. Additionally, it can serve as a building block for the synthesis of more complex organic molecules with medicinal properties. Its precise therapeutic potential and mode of action would need to be further explored through research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 68385-79-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,3,8 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 68385-79:
(7*6)+(6*8)+(5*3)+(4*8)+(3*5)+(2*7)+(1*9)=175
175 % 10 = 5
So 68385-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O3/c1-8(14)13-9-3-4-11(10(12)7-9)16-6-5-15-2/h3-4,7H,5-6,12H2,1-2H3,(H,13,14)
