68425-85-4 Usage
General Description
[1,2,3,9,10,16,17,23,24-nonabromo-11,25-dichloro-29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]copper is a complex chemical compound containing copper. It is a phthalocyanine derivative and has a complicated molecular structure. The compound is characterized by the presence of bromine, chlorine, and nitrogen atoms in its structure. Phthalocyanines are known for their intense color and are widely used as dyes, pigments, and in photovoltaic devices. The specific arrangement of the atoms in this compound contributes to its unique properties, making it potentially useful in various applications, including in the field of materials science and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 68425-85-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,4,2 and 5 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 68425-85:
(7*6)+(6*8)+(5*4)+(4*2)+(3*5)+(2*8)+(1*5)=154
154 % 10 = 4
So 68425-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C32H5Br9Cl2N8.Cu/c33-11-1-6-7(2-12(11)34)26-44-25(6)45-28-10-5-15(37)21(40)24(43)18(10)32(50-28)51-30-16-8(3-13(35)19(38)22(16)41)27(48-30)46-29-9-4-14(36)20(39)23(42)17(9)31(47-26)49-29;/h1-5H;/q-2;+2