68937-90-6 Usage
General Description
Trilinoleic Acid, chemically known as Tri((9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid) glycerol, is an ester derivative of linoleic acid, a polyunsaturated omega-6 fatty acid. Its structure is formed by a glycerol molecule that is esterified by three linoleic acid molecules. Trilinoleic Acid forms part of the oil or fat content in various plants and some animal fat reserves. It has been studied for its potential health benefits, as omega-6 fatty acids play a crucial role in brain function, as well as normal growth and development. However, the balance between omega-6 and omega-3 fatty acids in the diet significantly impacts the optimal health benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 68937-90-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,9,3 and 7 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 68937-90:
(7*6)+(6*8)+(5*9)+(4*3)+(3*7)+(2*9)+(1*0)=186
186 % 10 = 6
So 68937-90-6 is a valid CAS Registry Number.
InChI:InChI=1/C54H56O6/c1-2-3-4-5-6-7-8-9-12-18-23-28-33-38-43-48-53(57)59-51-46-41-36-31-26-21-16-11-14-19-24-29-34-39-44-49-54(58)60-50-45-40-35-30-25-20-15-10-13-17-22-27-32-37-42-47-52(55)56/h2-46,50-51H,1,47-49H2,(H,55,56)/b4-3+,6-5+,8-7+,12-9+,13-10+,14-11+,20-15+,21-16+,22-17+,23-18+,24-19+,30-25+,31-26+,32-27+,33-28+,34-29+,40-35+,41-36+,42-37+,43-38+,44-39+,50-45+,51-46+