68938-72-7 Usage
Description
Mesoporphyrin IX dihydrochloride is a naturally occurring porphyrin compound that plays a significant role in various applications due to its unique chemical and physical properties. It is characterized by its ability to absorb light in the visible region, making it a promising candidate for use in various industries.
Uses
Used in Solar Energy Industry:
Mesoporphyrin IX dihydrochloride is used as a reactant in constructing efficient dye-sensitized solar cells. Its light-absorbing properties and ability to facilitate charge transfer make it a valuable component in the development of solar cell technology, contributing to improved energy conversion efficiency and performance.
Check Digit Verification of cas no
The CAS Registry Mumber 68938-72-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,9,3 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 68938-72:
(7*6)+(6*8)+(5*9)+(4*3)+(3*8)+(2*7)+(1*2)=187
187 % 10 = 7
So 68938-72-7 is a valid CAS Registry Number.
InChI:InChI=1/C34H38N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h13-16,35-36H,7-12H2,1-6H3,(H,39,40)(H,41,42)/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-
68938-72-7Relevant articles and documents
METHODS FOR SYNTHESIZING METAL MESOPORPHYRINS
-
Page/Page column 9, (2012/10/08)
Embodiments describe methods of synthesizing metal mesoporphyrin compounds. In embodiments, a metal mesoporphyrin compound may be formed by hemin transmetallation and subsequent hydrogenation of the tin protoporphyrin IX to form a metal mesoporphyrin. In other embodiments, a method of synthesizing a metal mesoporphyrin compound comprises forming a protoporphyrin methyl ester from hemin and converting the protoporphyrin methyl ester intermediate to a metal mesoporphyrin compound through metal insertion and hydrogenation. In other embodiments, a metal mesoporphyrin compound may be formed from hemin by a hydrogen-free hydrogenation method to form a mesoporphyrin IX intermediate followed by metal insertion and hydrogenation. In embodiments, a method of synthesizing a metal mesoporphyrin compound comprises forming a mesoporphyrin IX dihydrochloride intermediate compound and converting the mesoporphyrin IX intermediate to a metal mesoporphyrin compound through metal insertion. In embodiments, a metal mesoporphyrin compound may be formed directly from hemin without isolation of any intermediates.