6957-14-8 Usage
Description
N-(2-pyridylmethyl)piperazine-1-ethylamine, also known as PEPAP, is a chemical compound belonging to the class of piperazine derivatives. It features a pyridine group and is utilized in the development and research of new drugs and pharmaceuticals. PEPAP exhibits a broad spectrum of pharmacological activities, with potential as a serotonin receptor agonist, making it a promising candidate for the treatment of various psychiatric and neurological disorders. Its distinctive chemical structure and properties render it a valuable tool for investigating the mechanisms of action and potential therapeutic effects of novel drug compounds.
Uses
Used in Pharmaceutical Research and Development:
PEPAP is employed as a chemical compound in the research and development of new drugs and pharmaceuticals. Its unique structure and properties make it a valuable tool for studying the mechanisms of action and potential therapeutic effects of novel drug compounds.
Used in Psychiatric and Neurological Disorders Treatment:
PEPAP is used as a potential serotonin receptor agonist for the treatment of various psychiatric and neurological disorders. Its pharmacological activities suggest that it may have therapeutic benefits in managing these conditions.
Used in Medicinal Chemistry:
PEPAP is utilized in medicinal chemistry as a potent candidate for the development of new drugs. Its pyridine group and piperazine derivative nature contribute to its potential as a therapeutic agent in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6957-14-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,5 and 7 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6957-14:
(6*6)+(5*9)+(4*5)+(3*7)+(2*1)+(1*4)=128
128 % 10 = 8
So 6957-14-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H20N4/c1-2-4-15-12(3-1)11-14-7-10-16-8-5-13-6-9-16/h1-4,13-14H,5-11H2
