69577-10-2 Usage
Biocidal Activity
Effective at killing or inhibiting the growth of microorganisms such as bacteria, fungi, and algae.
Corrosion Inhibition
Used in industrial settings to prevent the deterioration of metal surfaces.
Pharmaceutical Potential
Possesses antimicrobial properties, making it a candidate for use in the pharmaceutical industry.
Importance
An important compound in the field of chemistry due to its diverse applications and practical uses.
Physical Properties
The specific physical properties (e.g., melting point, boiling point, density, etc.) are not provided in the material, but they can be determined through experimentation.
Chemical Properties
The specific chemical properties (e.g., reactivity, stability, solubility, etc.) are not provided in the material, but they can be determined through experimentation.
Safety and Handling
Information on safety and handling precautions is not provided in the material, but it is essential to follow standard chemical handling procedures and consult relevant safety data sheets (SDS) for this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 69577-10-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,5,7 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 69577-10:
(7*6)+(6*9)+(5*5)+(4*7)+(3*7)+(2*1)+(1*0)=172
172 % 10 = 2
So 69577-10-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N2OS/c16-13-11-5-1-2-6-12(11)17-15(13)10-9-14-7-3-4-8-14/h1-2,5-6H,3-4,7-10H2
