69651-80-5 Usage
Description
(2S)-7-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-chroman-4-one is a complex organic compound with a unique molecular structure. It is characterized by its multiple hydroxyl and methoxy groups, as well as its chroman-4-one core. (2S)-7-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-chroman-4-one is likely to have various biological activities and potential applications in different fields due to its structural features.
Uses
1. Used in Pharmaceutical Applications:
(2S)-7-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-chroman-4-one is used as a pharmaceutical agent for its potential antioxidant and antitumor activities. The presence of multiple hydroxyl groups in its structure may contribute to its ability to neutralize free radicals and protect cells from oxidative damage. Additionally, its complex structure may allow it to interact with specific cellular targets, potentially leading to the inhibition of tumor growth.
2. Used in Cosmetic Applications:
In the cosmetic industry, (2S)-7-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-chroman-4-one may be used as an active ingredient in skincare products. Its antioxidant properties could help protect the skin from environmental stressors, while its potential antitumor activities may contribute to the prevention of skin cancer.
3. Used in Nutraceutical Applications:
As a nutraceutical, (2S)-7-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-chroman-4-one could be incorporated into dietary supplements or functional foods. Its antioxidant and potential antitumor properties may provide health benefits when consumed as part of a balanced diet.
4. Used in Research Applications:
In the field of scientific research, (2S)-7-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-chroman-4-one may serve as a valuable compound for studying the structure-activity relationships of various biologically active molecules. Its unique structure could provide insights into the design of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 69651-80-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,6,5 and 1 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 69651-80:
(7*6)+(6*9)+(5*6)+(4*5)+(3*1)+(2*8)+(1*0)=165
165 % 10 = 5
So 69651-80-5 is a valid CAS Registry Number.
InChI:InChI=1/C22H24O11/c1-30-13-3-2-9(4-11(13)25)14-7-12(26)18-15(31-14)5-10(24)6-16(18)32-22-21(29)20(28)19(27)17(8-23)33-22/h2-6,14,17,19-25,27-29H,7-8H2,1H3/t14-,17+,19+,20-,21+,22+/m0/s1