6968-75-8 Usage
General Description
3-METHYLBICYCLO(2.2.1)HEPTYL-2-METHANOL is a chemical compound with a unique and complex molecular structure. It consists of a bicyclic ring system with a methyl group and a hydroxyl group attached to it. 3-METHYLBICYCLO(2.2.1)HEPTYL-2-METHANOL is a tertiary alcohol, meaning it has a hydroxyl group attached to a carbon atom that is bonded to three other carbon atoms. With its intricate structure, 3-METHYLBICYCLO(2.2.1)HEPTYL-2-METHANOL has potential applications in various fields, including pharmaceuticals, agrochemicals, and as a chemical intermediate in organic synthesis. Its specific properties and reactivity make it a valuable compound for use in the development of new products and processes in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 6968-75-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,6 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6968-75:
(6*6)+(5*9)+(4*6)+(3*8)+(2*7)+(1*5)=148
148 % 10 = 8
So 6968-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H16O/c1-6-7-2-3-8(4-7)9(6)5-10/h6-10H,2-5H2,1H3
6968-75-8Relevant articles and documents
LUBRICATING OIL COMPOSITION AND LUBRICATING OIL COMPOSITION FOR CONTINUOUSLY VARIABLE TRANSMISSION
-
Paragraph 0070; 0071, (2013/05/22)
A lubricating oil composition of the invention contains longifolene represented by the following formula (1), that is, (1S,3aR,4S,8aS)-4,8,8-trimethyl-9-methylene-decahydro-1,4-methanoazulene.
Bicyclo[2,2,1] heptane derivative
-
Page 2, (2008/06/13)
A bicyclo[2.2.1]heptane derivative represented by following general formula (1): wherein R1 and R2 each represent hydrogen atom or methyl group, and R3 represents methyl group or ethyl group. The derivative is suitable as a high viscosity hydrocarbon base material used for tackfiers for adhesives and process oils for rubber and resins.
