69847-26-3 Usage
Description
1-Hydroxybenz[a]anthracene is a metabolite derived from the monohydroxy polycyclic aromatic hydrocarbon (PAH) toxin. It is a chemical compound that plays a significant role in the metabolism of PAHs, which are known for their toxic and carcinogenic properties.
Uses
1. Used in Environmental and Toxicological Studies:
1-Hydroxybenz[a]anthracene is used as a biomarker for [detecting the presence and impact of PAH toxins in the environment and biological systems]. It helps researchers understand the extent of PAH exposure and its potential health risks.
2. Used in Cancer Research:
1-Hydroxybenz[a]anthracene is used as a research tool for [studying the mechanisms of PAH-induced carcinogenesis and developing potential therapeutic strategies]. Its role in the metabolism of PAHs makes it a valuable compound for investigating the molecular pathways involved in cancer development and progression.
3. Used in Analytical Chemistry:
1-Hydroxybenz[a]anthracene is used as a reference compound for [calibrating analytical instruments and developing methods for detecting and quantifying PAHs in various samples]. Its unique chemical properties make it suitable for validating the accuracy and precision of analytical techniques.
4. Used in Pharmaceutical Industry:
1-Hydroxybenz[a]anthracene is used as a starting material for [synthesizing various pharmaceutical compounds with potential therapeutic applications]. Its structural features can be exploited to design and develop new drugs targeting specific diseases, including cancer.
5. Used in Material Science:
1-Hydroxybenz[a]anthracene is used as a component in [developing novel materials with specific optical, electronic, or mechanical properties]. Its chemical structure can be modified to create new materials with tailored characteristics for various applications, such as sensors, optoelectronics, or advanced composites.
Check Digit Verification of cas no
The CAS Registry Mumber 69847-26-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,8,4 and 7 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 69847-26:
(7*6)+(6*9)+(5*8)+(4*4)+(3*7)+(2*2)+(1*6)=183
183 % 10 = 3
So 69847-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H12O/c19-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17/h1-11,19H
69847-26-3Relevant articles and documents
Polyphenolic compounds
-
, (2008/06/13)
Novel polyphenolic compounds are disclosed. These compounds have utility as branching agents in the production of novel, randomly branched polycarbonates.