69946-37-8 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 6 carbon atoms, 7 hydrogen atoms, 3 nitrogen atoms, and 2 oxygen atoms.
Explanation
This term describes the specific arrangement of atoms and functional groups in the compound. The imidazole ring has a hydroxyl group (-OH) at the 5th position and a methyl group (-CH3) at the 2nd position. The 4th position has a carboxamide group (-CONH2).
Explanation
Imidazole is a five-membered ring structure containing two nitrogen atoms. The compound is a derivative of imidazole, meaning it has been chemically modified to include additional functional groups.
Explanation
These are the specific functional groups present in the compound, which contribute to its chemical properties and potential reactivity.
Explanation
Due to its structural features, the compound may have potential uses in the pharmaceutical industry or as a building block in organic synthesis. However, further research and testing are required to fully understand its properties and potential applications.
Explanation
The compound is derived from the imidazole ring, which is a common structural motif in many biologically active molecules and has been widely studied for its diverse range of applications.
Explanation
More research and testing are needed to fully understand the properties, reactivity, and potential uses of this compound. This may include studying its stability, solubility, and interactions with other molecules.
Structure
1H-Imidazole-4-carboxamide, 5-hydroxy-2-methyl-(9CI)
Heterocyclic Ring
Imidazole
Functional Groups
Hydroxyl (-OH), Methyl (-CH3), and Carboxamide (-CONH2)
Potential Applications
Pharmaceuticals, Organic Synthesis
Derivative
Imidazole
Further Research
Required
Check Digit Verification of cas no
The CAS Registry Mumber 69946-37-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,9,4 and 6 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 69946-37:
(7*6)+(6*9)+(5*9)+(4*4)+(3*6)+(2*3)+(1*7)=188
188 % 10 = 8
So 69946-37-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c1-2-7-3(4(6)9)5(10)8-2/h10H,1H3,(H2,6,9)(H,7,8)