70445-88-4 Usage
Alias
DMBT sulfoxide
Chemical Class
Sulfoxide
Structure
Contains a sulfur atom bonded to two carbon atoms and one oxygen atom
Common Uses
Intermediate in pharmaceutical and agrochemical synthesis
Potential therapeutic applications in anti-inflammatory and anti-cancer research
Industrial applications due to unique chemical properties
Chemical Properties
Chelating Agent: Exhibits the ability to form coordinate bonds with metal ions
Thermal Stability: Demonstrates high stability under elevated temperatures
Check Digit Verification of cas no
The CAS Registry Mumber 70445-88-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,4,4 and 5 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 70445-88:
(7*7)+(6*0)+(5*4)+(4*4)+(3*5)+(2*8)+(1*8)=124
124 % 10 = 4
So 70445-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H19N3O3/c1-3-7-15(8-4-2)14-10-11-9-12(16(18)19)5-6-13(11)17/h5-6,9-10,14H,3-4,7-8H2,1-2H3/b11-10-
