70446-11-6 Usage
Molecular structure
The compound has a complex and intricate structure with multiple functional groups.
Amino group presence
The compound contains a dimethylamino group (-N(CH3)2), which is a type of amino group.
Benzothiazolylidene group
The compound has a benzothiazolylidene group (a 1,3-benzothiazole ring with an exocyclic double bond), which may contribute to its biological activity.
Cyclohexenyl group
The compound includes a cyclohexenyl group (a six-membered carbon ring with one double bond), which can influence its chemical properties and reactivity.
Iodide group
The compound is an iodide salt, which means it contains an iodide ion (I-) as a counterion.
Ethylenic bond
The compound has an ethylenic bond (a carbon-carbon double bond) within its structure, which can be involved in various chemical reactions.
Potential pharmacological or biological activity
Due to the presence of multiple functional groups, the compound may exhibit pharmacological or biological activity, although further investigation is needed to determine its specific properties and uses.
Check Digit Verification of cas no
The CAS Registry Mumber 70446-11-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,4,4 and 6 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 70446-11:
(7*7)+(6*0)+(5*4)+(4*4)+(3*6)+(2*1)+(1*1)=106
106 % 10 = 6
So 70446-11-6 is a valid CAS Registry Number.
InChI:InChI=1/C30H34N3S2.HI/c1-5-32-24-14-7-9-16-26(24)34-28(32)20-18-22-12-11-13-23(30(22)31(3)4)19-21-29-33(6-2)25-15-8-10-17-27(25)35-29;/h7-10,14-21H,5-6,11-13H2,1-4H3;1H/q+1;/p-1