70446-28-5 Usage
Ethyl group
An ethyl group (CH3CH2-) is attached to the quinolinium core, which adds a carbon-carbon single bond to the structure.
Conjugated double bonds
The compound contains a series of conjugated double bonds (indicated by the (E) designation), which create a system of alternating single and double bonds. This can allow for the delocalization of electrons and can affect the compound's color and reactivity.
Cyclohexene group
A cyclohexene group (a six-membered ring with a double bond) is attached to the ethyl group, which adds a new ring structure to the molecule.
Methoxy group
A methoxy group (CH3O-) is attached to the cyclohexene ring, which adds an oxygen atom and a methyl group (CH3-) to the structure. This can affect the compound's polarity and solubility.
Potential pharmacological properties
Due to its complex structure and the presence of multiple functional groups, this compound has the potential to interact with biological systems and may have pharmacological properties. It can be used as a research tool and as a lead compound for the development of new drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 70446-28-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,4,4 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 70446-28:
(7*7)+(6*0)+(5*4)+(4*4)+(3*6)+(2*2)+(1*8)=115
115 % 10 = 5
So 70446-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C33H35N2O.HI/c1-4-34-29(21-17-25-11-6-8-15-31(25)34)23-19-27-13-10-14-28(33(27)36-3)20-24-30-22-18-26-12-7-9-16-32(26)35(30)5-2;/h6-9,11-12,15-24H,4-5,10,13-14H2,1-3H3;1H/q+1;/p-1