70660-55-8 Usage
General Description
The chemical "4-[(2-bromo-4,6-dinitrophenyl)azo]-N-(3-methoxypropyl)naphthalen-1-amine" is a complex organic compound. It consists of a naphthalene ring that is attached to an amine group and a propyl group. Additionally, it contains an azo group and a bromo-dinitrophenyl group. This chemical structure indicates that it may have applications in organic synthesis, pharmaceuticals, or dyes. The presence of the bromo and dinitro groups suggests it may have potential as a reagent or intermediate in chemical reactions. However, further testing and analysis would be required to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 70660-55-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,6,6 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 70660-55:
(7*7)+(6*0)+(5*6)+(4*6)+(3*0)+(2*5)+(1*5)=118
118 % 10 = 8
So 70660-55-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H18BrN5O5/c1-31-10-4-9-22-17-7-8-18(15-6-3-2-5-14(15)17)23-24-20-16(21)11-13(25(27)28)12-19(20)26(29)30/h2-3,5-8,11-12,22H,4,9-10H2,1H3/b24-23+