71412-23-2 Usage
General Description
3-(aminomethyl)pyrocatechol, also known as 3-aminomethylpyrocatechol, is an organic compound that consists of a catechol ring with an aminomethyl substituent at the 3-position. It is a derivative of pyrocatechol, and its chemical structure contains a nitrogen atom bonded to a carbon atom within the catechol ring. 3-(aminomethyl)pyrocatechol has potential applications in organic synthesis and medicinal chemistry due to its unique structure and reactivity. It could be used as a building block for the synthesis of various organic compounds, and its functional groups make it a valuable starting material for the development of pharmaceuticals and biologically active molecules. Further research and investigation into the properties and potential uses of 3-(aminomethyl)pyrocatechol could lead to its application in diverse fields such as drug discovery and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 71412-23-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,4,1 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71412-23:
(7*7)+(6*1)+(5*4)+(4*1)+(3*2)+(2*2)+(1*3)=92
92 % 10 = 2
So 71412-23-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2/c8-4-5-2-1-3-6(9)7(5)10/h1-3,9-10H,4,8H2
