7146-44-3 Usage
General Description
The chemical compound [(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]thiourea is a complex organic compound with a molecular structure composed of imidazolidine and thiourea moieties. It is commonly used as a reagent in organic synthesis and pharmaceutical research due to its diverse reactivity and potential pharmacological properties. [(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]thiourea has been studied for its potential as an antimicrobial, antifungal, and anti-inflammatory agent. Its molecular structure and properties make it a versatile compound for various applications in the fields of medicine and chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 7146-44-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,4 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7146-44:
(6*7)+(5*1)+(4*4)+(3*6)+(2*4)+(1*4)=93
93 % 10 = 3
So 7146-44-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N5O2S/c1-2-7(3-9-12-5(8)15)4(13)10-6(14)11-7/h3H,2H2,1H3,(H3,8,12,15)(H2,10,11,13,14)/b9-3+