7146-97-6 Usage
General Description
1H-Benzimidazole, 2-(methoxymethyl)-(9CI) is a chemical compound with the molecular formula C9H10N2O. It is a benzimidazole derivative with a methoxymethyl group attached to the second position of the benzimidazole ring. 1H-Benzimidazole,2-(methoxymethyl)-(9CI) has a wide range of potential applications due to its unique chemical structure, including use as a building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It is also known to exhibit antiviral and antibacterial properties, making it a potential candidate for drug development. Furthermore, this compound has been studied for its potential application in material science and polymer chemistry due to its reactivity with various functional groups. Overall, 1H-Benzimidazole, 2-(methoxymethyl)-(9CI) is a versatile chemical with potential use in various industries and research fields.
Check Digit Verification of cas no
The CAS Registry Mumber 7146-97-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,4 and 6 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7146-97:
(6*7)+(5*1)+(4*4)+(3*6)+(2*9)+(1*7)=106
106 % 10 = 6
So 7146-97-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O/c1-12-6-9-10-7-4-2-3-5-8(7)11-9/h2-5H,6H2,1H3,(H,10,11)