71555-10-7 Usage
Description
L-Lysine L-Malate is a dipeptide compound consisting of the essential amino acid L-Lysine and L-Malate, a component of the citric acid cycle. It plays a crucial role in various biological processes and has potential applications in different industries due to its unique properties.
Uses
Used in the Food Industry:
L-Lysine L-Malate is used as a flavor enhancer for its ability to improve the taste and quality of various food products. It enhances the umami taste, which is one of the basic flavors, and can be used in the production of seasonings, soups, and other savory dishes.
Used in the Medical Field:
L-Lysine L-Malate is used as a supplement for its potential health benefits. It can help with the absorption of calcium, which is essential for bone health, and may also have a role in immune system support and muscle function. Additionally, it is used in the preparation of amino acid ionic liquids, which have potential applications in drug delivery and other medical advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 71555-10-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,5,5 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 71555-10:
(7*7)+(6*1)+(5*5)+(4*5)+(3*5)+(2*1)+(1*0)=117
117 % 10 = 7
So 71555-10-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H14N2O2.C4H4O4/c7-4-2-1-3-5(8)6(9)10;5-3(6)1-2-4(7)8/h5H,1-4,7-8H2,(H,9,10);1-2H,(H,5,6)(H,7,8)/b;2-1-/t5-;/m0./s1
