71839-14-0 Usage
General Description
2,3-dihydro-2-methyl-9-phenyl-1H-indeno[2,1-c]pyridine hydrobromide is a chemical compound that belongs to the class of indole derivatives. It is commonly used in research and pharmaceutical applications for its potential therapeutic properties. 2,3-dihydro-2-methyl-9-phenyl-1H-indeno[2,1-c]pyridine hydrobromide has a unique chemical structure, which makes it a valuable tool for investigating biological processes and drug development. Its hydrobromide salt form enhances its solubility in aqueous solutions, making it more suitable for experimental and clinical use. Overall, the chemical "2,3-dihydro-2-methyl-9-phenyl-1H-indeno[2,1-c]pyridine hydrobromide" has promising properties and potential for various scientific and medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 71839-14-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,8,3 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 71839-14:
(7*7)+(6*1)+(5*8)+(4*3)+(3*9)+(2*1)+(1*4)=140
140 % 10 = 0
So 71839-14-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H17N.BrH/c1-20-12-11-16-15-9-5-6-10-17(15)19(18(16)13-20)14-7-3-2-4-8-14;/h2-11H,12-13H2,1H3;1H
