71884-56-5 Usage
Description
D-Proline, 1-glycyl(9CI) is a synthetic compound derived from the combination of D-proline and glycine, which are both amino acids. D-Proline, 1-glycyl(9CI) is characterized by its unique structure and properties, making it a valuable molecule for various applications in different fields.
Uses
Used in Pharmaceutical Research:
D-Proline, 1-glycyl(9CI) is used as a research compound for the theoretical study of angiotensin-converting enzyme (ACE) inhibitors. These inhibitors play a crucial role in regulating blood pressure and have potential applications in the treatment of hypertension and other cardiovascular diseases.
In this context, D-Proline, 1-glycyl(9CI) serves as a valuable tool for understanding the mechanisms of action and potential therapeutic effects of ACE inhibitors, contributing to the development of more effective drugs for cardiovascular health.
Check Digit Verification of cas no
The CAS Registry Mumber 71884-56-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,8,8 and 4 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 71884-56:
(7*7)+(6*1)+(5*8)+(4*8)+(3*4)+(2*5)+(1*6)=155
155 % 10 = 5
So 71884-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2O3/c8-4-6(10)9-3-1-2-5(9)7(11)12/h5H,1-4,8H2,(H,11,12)/t5-/m1/s1