71925-33-2 Usage
Type of compound
Dihydro derivative of methanonaphthalene
Functional groups
Contains two carbonitrile groups
Application
Building block for the synthesis of various organic compounds
Potential use
Production of pharmaceuticals, agrochemicals, and other fine chemicals
Field of relevance
Organic chemistry
Role
Valuable intermediate in the synthesis of complex organic molecules
Unique feature
Its unique structure and reactivity contribute to its value as an intermediate in organic synthesis
Check Digit Verification of cas no
The CAS Registry Mumber 71925-33-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,2 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71925-33:
(7*7)+(6*1)+(5*9)+(4*2)+(3*5)+(2*3)+(1*3)=132
132 % 10 = 2
So 71925-33-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H8N2/c14-6-8-2-1-3-11-9-4-10(7-15)12(5-9)13(8)11/h1-4,9,12H,5H2
