719282-11-8 Usage
Description
CHEMBRDG-BB 9070752, also known as 5-Acetamido-2-chlorobenzoic Acid, is an organic compound with potential applications in the pharmaceutical industry. It is characterized by its chemical structure, which includes an acetamido group and a chloro substituent on a benzoic acid backbone. This unique structure allows it to be used in the synthesis of various compounds with therapeutic potential.
Uses
Used in Pharmaceutical Industry:
CHEMBRDG-BB 9070752 is used as a key intermediate in the synthesis of 2-amino-5-substituted pyrimidine kinase inhibitors. These inhibitors are important for the development of novel therapeutic agents targeting various diseases, including cancer and other proliferative disorders.
Used in Therapy:
CHEMBRDG-BB 9070752 is also utilized in the development of therapeutic agents for the treatment of specific diseases. By incorporating CHEMBRDG-BB 9070752 into the molecular structure of these agents, researchers can potentially enhance their efficacy and selectivity, leading to improved treatment outcomes for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 719282-11-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,1,9,2,8 and 2 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 719282-11:
(8*7)+(7*1)+(6*9)+(5*2)+(4*8)+(3*2)+(2*1)+(1*1)=168
168 % 10 = 8
So 719282-11-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClNO3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)
719282-11-8Relevant articles and documents
2-AMINO-5-SUBSTITUTED PYRIMIDINE INHIBITORS
-
Page/Page column 115, (2010/11/29)
Compounds having the general structure (A) are provided. The compounds of the invention are capable of inhibiting kinases, such as members of the Src kinase family, Vegfr and various other specific receptor and non-receptor kinases. Formula (I):
