7195-47-3 Usage
General Description
Tetrakis(oxiranylmethyl) benzene-1,2,4,5-tetracarboxylate is a chemical compound composed of a benzene core with four carboxylate groups and four oxiranylmethyl (epoxy) groups attached to the benzene ring. tetrakis(oxiranylmethyl) benzene-1,2,4,5-tetracarboxylate is commonly used as a cross-linking agent in the production of epoxy resins and can also be incorporated into polymer materials to enhance their mechanical properties. It is known for its ability to improve the adhesion, toughness, and thermal stability of epoxy-based products, making it a valuable additive in various industrial applications. Additionally, the compound is also used in the manufacturing of adhesives, coatings, and composite materials, further highlighting its versatility and importance in modern chemical and material industries.
Check Digit Verification of cas no
The CAS Registry Mumber 7195-47-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,9 and 5 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7195-47:
(6*7)+(5*1)+(4*9)+(3*5)+(2*4)+(1*7)=113
113 % 10 = 3
So 7195-47-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H22O12/c23-19(31-7-11-3-27-11)15-1-16(20(24)32-8-12-4-28-12)18(22(26)34-10-14-6-30-14)2-17(15)21(25)33-9-13-5-29-13/h1-2,11-14H,3-10H2