71989-91-8 Usage
Description
(bicyclo[2.2.1]hept-5-en-2-yl)methyl 2-chloroacrylate is a chemical compound that is a derivative of both bicyclo[2.2.1]hept-5-en-2-yl and 2-chloroacrylate. It is a colorless liquid with a molecular formula of C10H13ClO2, known for its utility in organic synthesis and its potential reactivity in various chemical reactions.
Uses
Used in Organic Synthesis:
(bicyclo[2.2.1]hept-5-en-2-yl)methyl 2-chloroacrylate is used as a reagent for the construction of complex molecular structures in the field of organic synthesis. Its ability to undergo addition and substitution reactions allows for the formation of a wide range of different organic compounds, making it a valuable tool in the creation of novel molecules and materials.
Used in Chemical Research:
In the chemical research industry, (bicyclo[2.2.1]hept-5-en-2-yl)methyl 2-chloroacrylate is used as a starting material for the development of new chemical processes and the synthesis of new compounds. Its unique structure and reactivity make it an interesting candidate for exploring new reaction pathways and mechanisms.
Used in Pharmaceutical Development:
(bicyclo[2.2.1]hept-5-en-2-yl)methyl 2-chloroacrylate may also find application in the pharmaceutical industry as a building block for the synthesis of new drugs. Its versatility in undergoing various chemical reactions can be harnessed to create molecules with potential therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 71989-91-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,8 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 71989-91:
(7*7)+(6*1)+(5*9)+(4*8)+(3*9)+(2*9)+(1*1)=178
178 % 10 = 8
So 71989-91-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H13ClO2/c1-7(12)11(13)14-6-10-5-8-2-3-9(10)4-8/h2-3,8-10H,1,4-6H2
