720-69-4 Usage
General Description
S-Triazine,4,6-diamino-2-(5-nitro-2-furyl)- is a chemical compound that belongs to the triazine class of compounds, characterized by a six-member ring structure containing three nitrogen atoms. The compound contains two amino groups and a nitro-furyl group, making it a versatile building block for the synthesis of various biologically active molecules. It has been studied for its potential use in medicinal chemistry, particularly in the development of anti-cancer and anti-microbial agents. The nitro-furyl group in the compound is known for its antibacterial and antifungal properties, while the triazine ring structure offers structural diversity and stability, making it a valuable scaffold for drug development. Further research is needed to explore the full potential of S-triazine,4,6-diamino-2-(5-nitro-2-furyl)- in therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 720-69-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,2 and 0 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 720-69:
(5*7)+(4*2)+(3*0)+(2*6)+(1*9)=64
64 % 10 = 4
So 720-69-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N6O3/c8-6-10-5(11-7(9)12-6)3-1-2-4(16-3)13(14)15/h1-2H,(H4,8,9,10,11,12)
