72189-84-5 Usage
General Description
LYS-LYS-GLY-GLU is a chemical compound consisting of the amino acids lysine (Lys), glycine (Gly), and glutamic acid (Glu) linked together in a specific sequence. Lysine is an essential amino acid with a role in protein synthesis, collagen production, and immune function. Glycine is a non-essential amino acid with roles in protein synthesis, enzyme function, and neurotransmission. Glutamic acid is a non-essential amino acid involved in protein synthesis and the production of the neurotransmitter gamma-aminobutyric acid (GABA). When combined in the sequence LYS-LYS-GLY-GLU, these amino acids may have specific biological effects, potentially influencing protein structure, function, or signaling pathways in the body.
Check Digit Verification of cas no
The CAS Registry Mumber 72189-84-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,1,8 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 72189-84:
(7*7)+(6*2)+(5*1)+(4*8)+(3*9)+(2*8)+(1*4)=145
145 % 10 = 5
So 72189-84-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H36N6O7/c20-9-3-1-5-12(22)17(29)25-13(6-2-4-10-21)18(30)23-11-15(26)24-14(19(31)32)7-8-16(27)28/h12-14H,1-11,20-22H2,(H,23,30)(H,24,26)(H,25,29)(H,27,28)(H,31,32)