721958-70-9 Usage
General Description
4-(3-aminophenyl)piperidine hydrochloride is a chemical compound with the molecular formula C11H16ClN. It is a piperidine derivative with an aminophenyl group attached to the fourth carbon atom. 4-(3-AMINOPHENYL)PIPERIDINE HYDROCHLORIDE is commonly used in the synthesis of pharmaceutical drugs and is known for its potential therapeutic applications. It has been studied for its potential role in the treatment of various medical conditions such as depression, anxiety, and neuropathic pain. Additionally, it has also been investigated for its potential use in the development of new psychoactive drugs. The hydrochloride salt form of 4-(3-aminophenyl)piperidine is typically more stable and water-soluble, making it easier to handle and use in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 721958-70-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,2,1,9,5 and 8 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 721958-70:
(8*7)+(7*2)+(6*1)+(5*9)+(4*5)+(3*8)+(2*7)+(1*0)=179
179 % 10 = 9
So 721958-70-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2.2ClH/c12-11-3-1-2-10(8-11)9-4-6-13-7-5-9;;/h1-3,8-9,13H,4-7,12H2;2*1H
