7225-68-5 Usage
Chemical class
Alkanes, because it is a saturated hydrocarbon.
Molecular weight
348.65 g/mol, representing the mass of one mole of the compound.
Cyclopentyl group
A five-carbon ring structure, which is part of the compound's structure.
Cyclopentylpropyl group
A cyclopentyl group attached to a propyl chain, another part of the compound's structure.
Number of carbon atoms
25, as indicated by the molecular formula.
Industrial applications
The compound may have various uses in different industries due to its specific chemical structure and properties.
Usage in organic chemistry and chemical synthesis
The compound is commonly used as a building block or intermediate in the synthesis of other organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 7225-68-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,2 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 7225-68:
(6*7)+(5*2)+(4*2)+(3*5)+(2*6)+(1*8)=95
95 % 10 = 5
So 7225-68-5 is a valid CAS Registry Number.
InChI:InChI=1/C25H48/c1-2-3-4-5-6-7-14-25(21-12-19-23-15-8-9-16-23)22-13-20-24-17-10-11-18-24/h23-25H,2-22H2,1H3