723-09-1 Usage
General Description
(2,5-DIOXO-4,4-DIPROPYLIMIDAZOLIDIN-1-YL)ACETIC ACID is a chemical compound with the molecular formula C11H18N2O4. It is a derivative of imidazole and contains a five-membered ring structure. (2,5-DIOXO-4,4-DIPROPYLIMIDAZOLIDIN-1-YL)ACETIC ACID is commonly used in pharmaceutical research and drug development due to its potential biological activities. It has been studied for its potential antitumor and antimicrobial properties, as well as its ability to modulate immune and inflammatory responses. Additionally, (2,5-DIOXO-4,4-DIPROPYLIMIDAZOLIDIN-1-YL)ACETIC ACID has been investigated for its potential use in the treatment of various medical conditions, including cancer and infectious diseases. Its unique chemical structure and potential therapeutic properties make it an important and valuable compound in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 723-09-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,2 and 3 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 723-09:
(5*7)+(4*2)+(3*3)+(2*0)+(1*9)=61
61 % 10 = 1
So 723-09-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H18N2O4/c1-3-5-11(6-4-2)9(16)13(7-8(14)15)10(17)12-11/h3-7H2,1-2H3,(H,12,17)(H,14,15)/p-1