723510-50-7 Usage
Structural features
Contains a piperazine derivative with an ethanol group attached
Specific structure
Piperazinylethanol with a pyrimidinylamine group attached to the piperazine ring
Common use
Pharmaceutical intermediate in the synthesis of various drugs
Potential applications
Medicinal chemistry and drug discovery research
Pharmacological properties
Potential pharmacological properties due to its structure and chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 723510-50-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,2,3,5,1 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 723510-50:
(8*7)+(7*2)+(6*3)+(5*5)+(4*1)+(3*0)+(2*5)+(1*0)=127
127 % 10 = 7
So 723510-50-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H19N5O/c1-9-13-10(12)8-11(14-9)16-4-2-15(3-5-16)6-7-17/h8,17H,2-7H2,1H3,(H2,12,13,14)