72388-18-2 Usage
Description
2-Dodecylhexadecan-1-ol is a long-chain alcohol with a hydrophilic hydroxyl group and a hydrophobic alkyl chain. It is characterized by its amphiphilic nature, which allows it to interact with both polar and nonpolar molecules.
Used in Cosmetics Industry:
2-Dodecylhexadecan-1-ol is used as a surfactant in cosmetics for its ability to reduce the surface tension of water, allowing for better dispersion and solubility of other ingredients. This improves the texture, spreadability, and absorption of cosmetic products on the skin.
Used in Organic Synthesis:
2-Dodecylhexadecan-1-ol is used as a reagent to synthesize amphiphilic glycosylamides, which are compounds with both hydrophilic and hydrophobic properties. These glycosylamides have potential applications in various fields, such as drug delivery and material science, due to their unique properties and self-assembling capabilities.
Check Digit Verification of cas no
The CAS Registry Mumber 72388-18-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,3,8 and 8 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 72388-18:
(7*7)+(6*2)+(5*3)+(4*8)+(3*8)+(2*1)+(1*8)=142
142 % 10 = 2
So 72388-18-2 is a valid CAS Registry Number.
InChI:InChI=1/C28H58O/c1-3-5-7-9-11-13-15-16-18-20-22-24-26-28(27-29)25-23-21-19-17-14-12-10-8-6-4-2/h28-29H,3-27H2,1-2H3