7252-23-5 Usage
Description
(Z)-3-(pyridin-3-ylmethylcarbamoyl)prop-2-enoic acid is a carboxylic acid derivative characterized by the presence of a pyridine ring attached to a carbamoyl group and a propenoic acid group. This unique molecular structure endows it with the potential to act as a chelating agent, enabling the formation of stable complexes with metal ions. Its ability to coordinate with metals and exhibit biological activity suggests possible applications in various fields, including pharmaceuticals, coordination chemistry, and materials science.
Uses
Used in Pharmaceutical Applications:
(Z)-3-(pyridin-3-ylmethylcarbamoyl)prop-2-enoic acid is used as a ligand compound for its potential to form coordination complexes with metal ions, which can be beneficial in the development of new drugs or drug delivery systems. Its chelating properties may also contribute to its use in targeting specific metal ion-related diseases or conditions.
Used in Coordination Chemistry:
In the field of coordination chemistry, (Z)-3-(pyridin-3-ylmethylcarbamoyl)prop-2-enoic acid is used as a chelating agent to form stable complexes with metal ions. These complexes can be studied for their structural, electronic, and magnetic properties, which may lead to a better understanding of metal ion interactions and their role in various chemical processes.
Used in Materials Science:
(Z)-3-(pyridin-3-ylmethylcarbamoyl)prop-2-enoic acid may be utilized in materials science for the development of new materials with unique properties. Its ability to form coordination complexes can be exploited to create materials with tailored characteristics, such as enhanced stability, selectivity, or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 7252-23-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,5 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7252-23:
(6*7)+(5*2)+(4*5)+(3*2)+(2*2)+(1*3)=85
85 % 10 = 5
So 7252-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O3/c13-9(3-4-10(14)15)12-7-8-2-1-5-11-6-8/h1-6H,7H2,(H,12,13)(H,14,15)/b4-3-
