72677-92-0 Usage
Description
6-Methoxy-5-nitroisoquinoline is an organic compound that serves as a valuable synthetic intermediate in the chemical industry. It is characterized by its pale yellow solid appearance and holds potential for various applications due to its unique chemical structure.
Uses
Used in Pharmaceutical Industry:
6-Methoxy-5-nitroisoquinoline is used as a synthetic intermediate for the development of various pharmaceutical compounds. Its chemical properties make it a suitable candidate for the synthesis of new drugs, potentially leading to the creation of novel treatments for a range of medical conditions.
Used in Chemical Research:
As a synthetic intermediate, 6-Methoxy-5-nitroisoquinoline is also utilized in chemical research to explore new reactions and pathways. This can contribute to the advancement of chemical knowledge and the discovery of innovative applications in various fields.
Used in Dye Industry:
6-Methoxy-5-nitroisoquinoline can be employed as a synthetic intermediate in the production of dyes. Its unique chemical structure may contribute to the development of new dye formulations with improved properties, such as enhanced colorfastness or reduced environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 72677-92-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,6,7 and 7 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 72677-92:
(7*7)+(6*2)+(5*6)+(4*7)+(3*7)+(2*9)+(1*2)=160
160 % 10 = 0
So 72677-92-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O3/c1-15-9-3-2-7-6-11-5-4-8(7)10(9)12(13)14/h2-6H,1H3
72677-92-0Relevant articles and documents
THE SYNTHESIS OF THREE ISOMERS OF THE FOOD CARCINOGEN IQ
Ronne, Erik,Grivas, Spiros
, p. 101 - 105 (2007/10/02)
2-Amino-3-methyl-3H-imidazoquinoline, 2-amino-3-methyl-3H-imidazoisoquinoline and 2-amino-3-methyl-3H-imidazoisoquinoline were synthesized from 7-methoxyquinoline, 6- and 7-methoxyisoquinolines in 21-28percent overall yields.
