7280-83-3 Usage
General Description
2,6-Diaminopurine sulfate is a derivative of purine and is a chemical compound that has been studied for its potential biological and pharmaceutical applications. It is a purine analog that has been investigated for its potential use in treating various medical conditions, including cancer, viral infections, and as a potential immunosuppressant. Studies have shown that 2,6-diaminopurine sulfate has the potential to inhibit the growth of cancer cells and viruses, making it a promising candidate for further research and development. Additionally, its potential immunosuppressant properties make it of interest for treating autoimmune diseases and transplant rejection. Further research is needed to fully understand its potential therapeutic applications and to assess its safety and efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 7280-83-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,8 and 0 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7280-83:
(6*7)+(5*2)+(4*8)+(3*0)+(2*8)+(1*3)=103
103 % 10 = 3
So 7280-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N6.H2O4S.2H2O/c6-3-2-4(9-1-8-2)11-5(7)10-3;1-5(2,3)4;;/h1H,(H5,6,7,8,9,10,11);(H2,1,2,3,4);2*1H2