73086-98-3 Usage
Description
D-A-AMINOXY-B-PHENYLPROPIONIC ACID, HYDROBROMIDE is a chemical compound that serves as an intermediate in the synthesis of optically active amino acids. It is a white powder in its chemical form.
Uses
Used in Pharmaceutical Industry:
D-A-AMINOXY-B-PHENYLPROPIONIC ACID, HYDROBROMIDE is used as an intermediate for the synthesis of optically active amino acids, which are essential building blocks for various pharmaceutical applications. These amino acids are crucial in the development of drugs targeting specific biological processes and can be used to create more effective and targeted treatments for a range of medical conditions.
Used in Chemical Synthesis:
D-A-AMINOXY-B-PHENYLPROPIONIC ACID, HYDROBROMIDE is used as a key component in the synthesis of various chemical compounds. Its unique structure allows for the creation of new molecules with specific properties, which can be applied in different industries, such as materials science, agriculture, and environmental management.
Used in Research and Development:
As a versatile intermediate, D-A-AMINOXY-B-PHENYLPROPIONIC ACID, HYDROBROMIDE is also used in research and development for the exploration of new chemical reactions and the creation of novel compounds with potential applications in various fields. This includes the development of new pharmaceuticals, advanced materials, and innovative solutions for environmental challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 73086-98-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,0,8 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 73086-98:
(7*7)+(6*3)+(5*0)+(4*8)+(3*6)+(2*9)+(1*8)=143
143 % 10 = 3
So 73086-98-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO3.BrH/c10-13-8(9(11)12)6-7-4-2-1-3-5-7;/h1-5,8H,6,10H2,(H,11,12);1H/t8-;/m0./s1
