731-40-8 Usage
General Description
Thalidomide is a synthetic derivative of glutamic acid that was initially developed as a sedative and anti-nausea medication. However, it was later found to cause severe birth defects, leading to its withdrawal from the market. Thalidomide is a chiral molecule, meaning it exists in two mirror-image forms, known as enantiomers, designated as (+) and (-). The (+) enantiomer has sedative effects and was responsible for the adverse effects on fetuses, while the (-) enantiomer has shown potential as a treatment for conditions such as leprosy and multiple myeloma. Thalidomide has complex pharmacological properties and is currently used under strict regulation for specific medical conditions, with thorough monitoring to prevent the occurrence of birth defects.
Check Digit Verification of cas no
The CAS Registry Mumber 731-40-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,3 and 1 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 731-40:
(5*7)+(4*3)+(3*1)+(2*4)+(1*0)=58
58 % 10 = 8
So 731-40-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17)