73179-35-8 Usage
Chemical class
Polyether diol
This compound belongs to a class of organic compounds characterized by the presence of multiple ether groups (-O-) in their structure.
Diol functionality
Contains two hydroxyl (OH) groups
The presence of two hydroxyl groups indicates that this compound is a diol, which can participate in various chemical reactions, such as esterification and condensation.
Methyl groups
Two methyl (CH3) groups at positions 11 and 15
The presence of methyl groups suggests potential biological activity or reactivity, as they can influence the compound's properties and interactions with other molecules.
Pentaoxapentacosane
Contains five oxygen atoms in the main chain
Long-chain organic molecule
Consists of a long carbon chain
The compound has a long carbon chain, which can influence its physical properties, such as solubility and melting/boiling points.
Water solubility
Likely some degree of water solubility
Due to the presence of multiple oxygen atoms and hydroxyl groups, the compound may have some degree of water solubility, which can be important for its potential applications.
Biological activity
Potential for biological activity or reactivity
The presence of methyl groups and the diol functionality may suggest that this compound has potential biological activity or reactivity, which could be relevant for its use in various applications.
Specific properties
Depend on exact structure and purity
The specific properties of this compound, such as its reactivity, stability, and potential applications, would depend on its exact molecular structure and purity.
Potential uses
Unknown without further information
Without more information on the compound's specific properties and potential applications, it is difficult to determine its potential uses. However, its polyether diol nature and the presence of methyl groups may suggest potential applications in fields such as pharmaceuticals, materials science, or chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 73179-35-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,1,7 and 9 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73179-35:
(7*7)+(6*3)+(5*1)+(4*7)+(3*9)+(2*3)+(1*5)=138
138 % 10 = 8
So 73179-35-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H46O7/c1-5-7-9-11-13-25-17-21(23)28-19(3)15-27-16-20(4)29-22(24)18-26-14-12-10-8-6-2/h19-24H,5-18H2,1-4H3