73331-93-8 Usage
General Description
PIPERAZIN-1-YL-PYRROLIDIN-1-YL-METHANONE is a chemical compound with the molecular formula C11H20N2O. It is a ketone derivative with a piperazine and pyrrolidine ring structure. PIPERAZIN-1-YL-PYRROLIDIN-1-YL-METHANONE is primarily used in the pharmaceutical industry as a building block for the synthesis of various drug molecules. It has also been studied for its potential pharmacological activities, including its potential as a monoamine oxidase inhibitor and its effects on the central nervous system. Additionally, it has been investigated as a potential ligand for various receptors and enzymes. Further research is needed to fully understand the potential uses and effects of PIPERAZIN-1-YL-PYRROLIDIN-1-YL-METHANONE.
Check Digit Verification of cas no
The CAS Registry Mumber 73331-93-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,3,3 and 1 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 73331-93:
(7*7)+(6*3)+(5*3)+(4*3)+(3*1)+(2*9)+(1*3)=118
118 % 10 = 8
So 73331-93-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H17N3O/c13-9(11-5-1-2-6-11)12-7-3-10-4-8-12/h10H,1-8H2
73331-93-8Relevant articles and documents
DPP-4 Inhibitor and preparation method thereof
-
Paragraph 0032; 0034-0038, (2020/05/14)
The invention discloses a pyrimidinedione compound and application thereof, and further discloses a pharmaceutical composition containing the pyrimidinedione compound. The compound or the pharmaceutical composition can be used as a dipeptidyl peptidase-IV (DPP-4) inhibitor.