7355-51-3 Usage
General Description
P-(2-cyclohexenyloxy)benzoic acid is an organic compound with the chemical formula C15H14O3. It consists of a benzene ring with a carboxylic acid substituent and a cyclohexene group attached to the benzene ring. This chemical is primarily used in the production of pharmaceuticals, particularly non-steroidal anti-inflammatory drugs (NSAIDs), due to its anti-inflammatory and pain-relief properties. It has also been studied for its potential applications in the field of organic electronics and optoelectronics due to its unique electronic and optical properties. Additionally, p-(2-cyclohexenyloxy)benzoic acid has been investigated for its potential antimicrobial and anti-cancer activities, making it a versatile compound with a range of potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 7355-51-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,5 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7355-51:
(6*7)+(5*3)+(4*5)+(3*5)+(2*5)+(1*1)=103
103 % 10 = 3
So 7355-51-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H14O3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h2,4,6-9,11H,1,3,5H2,(H,14,15)
